Smokeclown Smokeclown

12-05-2017
Chemistry

contestada

balance this equation
Pb(NO3)2+Na2(CrO4)=Pb(CtO4)+Na(NO3)

Respuesta :

haneylia haneylia

12-05-2017

I'm guessing you mean Cr (Chromium) in the product instead of Ct.

Pb(NO3)2 + Na2(CrO4) = Pb(CtO4) + 2Na(NO3)

Answer Link

Otras preguntas

Match the following items. 1. prefix meaning 1/1,000 meter 2. prefix measuring 1,000 liter 3. prefix meaning 1/100 milli 4. base unit of distance centi

The peripheral nervous system is made up of the brain and spinal cord. a. True b. False

What is the best way to learn french at home????

An object that is made of which material is likely to be attracted to a magnet? nitrogen nickel paper plastic

If you wanted to use the numeric key pad to divide 100 by 2, you would type _____. 2/100 100-2 100*2 100/2

Taxonomy _____. brings order to understanding the immense diversity of life is an unnecessary science is a classification system is the study of animal behavio

what does cual es la fecha de manana means

Which one of these helps create water pollution? a. carbon dioxide b. chlorofluorocarbons c. nitrates d. dust particles

the amount of water in a bottle is reduced by 85% to 120 milliters how many water was originally in the bottle.

Putting thoughts into words requires a knowledge of a language's structure and vocabulary