Destiny1262016 Destiny1262016

12-10-2016
Social Studies

contestada

How did Egyptians use the natural resources they had?

Respuesta :

WorldlyGlass49 WorldlyGlass49

12-10-2016

They had the Nile with them which was the best natural resource out there. The river would help them have great and fertile soil, which they could also irrigate and have an easy job developing agriculture.

Answer Link

Otras preguntas

Which two of the following sentences from the article include CENTRAL ideas of the article? 1.She was forced to travel a mile to an all-black school even though

Q. What is point of view in regards to literature? A) Point of view is who is telling the story. B) The way a writer creates a connection to the characters in

I kinda need help :< For each coordinate grid, identify a pair of congruent figures. Then determine a congruence transformation that maps the pre-image to th

How did the Union army benefit from formerly enslaved people?

How many votes does it take to get speaker of the House?

Draw the best Lewis structure for CH3CH(CH3)CH2C(CH2CH3)2CHO, a neutral molecule. HELP PLEASE

By what reproductive mechanism does a haplontic animal grow? A. initially by meiosis, then by mitosis B. completely by mitosis C. initially mitosis, then meiosi

Using Table 11.4 as an example, create two alternative access plans. Use the following assumptions: a. There are 8,000 employees. b. There are 4,150 female empl

A town has a population of 53,800 and shrinks at a rate of 2.5% every year. Which equation represents the town's population after 3 years?

A party of 300 people,54% will have someone to kiss when the clock strikes midnight.How many people will have someone to kiss?