lakeda25 lakeda25

13-10-2020
Mathematics

contestada

what is the area of a rectangles with the side lengths 5 inches and 4/3 inches?

Respuesta :

elliecn0313 elliecn0313

14-10-2020

Answer: 20/3 square inches

Step-by-step explanation:

Area = length*width

length = 5 in.

width = 4/3 in.

A = 5 * (4/3) = 20/3 in^2

Answer Link

Otras preguntas

Describe this painting in detail

Order the numbers (1.1)2, (1.4)10, and (1.5)16 from smallest to largest

5. Ama has 30 oranges. She gave 20% to her friends. Find the number of oranges that Ama gave to her friend

The transition elements are a block of elements between Groups 2 and 3 of the periodic table. (i) Transition elements have similar properties. Explain why, in t

in French: Write about your country 1. Comment s'appelle ton pays? 2.Ou se trouve ton pays? 3.Quelle est la capitable ton pays? 4. Quelle est la population de t

The area of a circle is 616 cm². Find its circumference. Use π = 22/7 A) 88 cm B) 44 cm C) 88 cm² D) 44 cm²

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2

why are the products in the philippines written in english even though tagalog is their original language and other countries are the product is only their own

Saying ‘yes’ and ‘no’ are two contrasting situations. How and why both the situations can be a sign of bravery? Discuss your answer in the light of the statemen

Which type of mutation happens when an organism has extra genetic material? O Deletion O Duplication O Inversion O Translocation