xxaurorabluexx xxaurorabluexx

13-02-2019
Mathematics

contestada

Which angle in triangle ABC has the smallest measure?

Which angle in triangle ABC has the smallest measure class=

Respuesta :

kamaldeep0625 kamaldeep0625

13-02-2019

Answer:

Angle B

Step-by-step explanation:

To find the smallest angle it is the opposite of the smallest side in the triangle in this case as all sides are given.

Answer Link

Otras preguntas

what is the crickets hang time

Assessment A. Directions: Read and understand each question. Write the letter of the most appropriate answer in your science notebook. _____1. You see dark clou

▼ Part A How many moles of carbon monoxide are needed to react completely with 136 kg of Fe2O3.

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2

The graph of F(x), shown below, resembles the graph of G(x) = x², but it has been changed somewhat. Which of the following could be the equation of F(x)?

Any good ww2 summarized links? Would prefer short and summarized ones since I'm just trying to take a general look. Both videos and texts work. Doesn't have to

A vessel has 4 liters and 500 ml of curd. In how many glasses, each of 25 ml capacity, can it be filled?Please answer

Which if the following is a possible delay in in hospital care to definitive treatment for patients experiencing an acute myocardial infarction

You rent an apartment that costs $1700 per month during the first year, but the rent is set to go up $70 per year. Write a recursive formula to show what the re

A bag of sweets contains 7 strawberry, 9 blueberry. Joe picks two sweets at random. Find the probability that Joe picks two sweets that are different flavours.